About 5,8-difluoro-1,4-dioxo-3H-phthalazine-2-carbothioamide
5,8-difluoro-1,4-dioxo-3H-phthalazine-2-carbothioamide (PubChem CID 11402635) has the molecular formula C9H5F2N3O2S
and a molecular weight of 257.22 g/mol. Its IUPAC name is 5,8-difluoro-1,4-dioxo-3H-phthalazine-2-carbothioamide.
Molecular Properties
| Compound Name | 5,8-difluoro-1,4-dioxo-3H-phthalazine-2-carbothioamide |
| PubChem CID | 11402635 |
| Molecular Formula | C9H5F2N3O2S |
| Molecular Weight | 257.22 g/mol |
| Exact Mass | 257.01 |
| IUPAC Name | 5,8-difluoro-1,4-dioxo-3H-phthalazine-2-carbothioamide |
| SMILES | NC(=S)n1[nH]c(=O)c2c(F)ccc(F)c2c1=O |
| InChI | InChI=1S/C9H5F2N3O2S/c10-3-1-2-4(11)6-5(3)7(15)13-14(8(6)16)9(12)17/h1-2H,(H2,12,17)(H,13,15) |
| InChIKey | UEJCXXRGGCZORG-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 80.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.22 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 5,8-difluoro-1,4-dioxo-3H-phthalazine-2-carbothioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,8-difluoro-1,4-dioxo-3H-phthalazine-2-carbothioamide?
The IUPAC name of 5,8-difluoro-1,4-dioxo-3H-phthalazine-2-carbothioamide (CID 11402635) is 5,8-difluoro-1,4-dioxo-3H-phthalazine-2-carbothioamide.
What is the SMILES notation for 5,8-difluoro-1,4-dioxo-3H-phthalazine-2-carbothioamide?
The canonical SMILES for 5,8-difluoro-1,4-dioxo-3H-phthalazine-2-carbothioamide is NC(=S)n1[nH]c(=O)c2c(F)ccc(F)c2c1=O.
What is the InChIKey of 5,8-difluoro-1,4-dioxo-3H-phthalazine-2-carbothioamide?
The InChIKey is UEJCXXRGGCZORG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5F2N3O2S/c10-3-1-2-4(11)6-5(3)7(15)13-14(8(6)16)9(12)17/h1-2H,(H2,12,17)(H,13,15).
What are the key properties of 5,8-difluoro-1,4-dioxo-3H-phthalazine-2-carbothioamide?
5,8-difluoro-1,4-dioxo-3H-phthalazine-2-carbothioamide has a molecular weight of 257.22 g/mol, XLogP of 0.06, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5,8-difluoro-1,4-dioxo-3H-phthalazine-2-carbothioamide is sourced from PubChem (CID 11402635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).