C13H10BrF2IN2 — CID 114027340
[(2-bromo-5-iodophenyl)-(2,4-difluorophenyl)methyl]hydrazine (PubChem CID 114027340) has the molecular formula C13H10BrF2IN2 and a molecular weight of 439.04 g/mol. Its IUPAC name is [(2-bromo-5-iodophenyl)-(2,4-difluorophenyl)methyl]hydrazine.
| Compound Name | [(2-bromo-5-iodophenyl)-(2,4-difluorophenyl)methyl]hydrazine |
|---|---|
| PubChem CID | 114027340 |
| Molecular Formula | C13H10BrF2IN2 |
| Molecular Weight | 439.04 g/mol |
| Exact Mass | 437.90 |
| IUPAC Name | [(2-bromo-5-iodophenyl)-(2,4-difluorophenyl)methyl]hydrazine |
| SMILES | NNC(c1ccc(F)cc1F)c1cc(I)ccc1Br |
| InChI | InChI=1S/C13H10BrF2IN2/c14-11-4-2-8(17)6-10(11)13(19-18)9-3-1-7(15)5-12(9)16/h1-6,13,19H,18H2 |
| InChIKey | BVGZIENRXMJJEX-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.04 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|