C15H19BrClNO — CID 114028204
[4-(1-bromoethyl)piperidin-1-yl]-(4-chloro-2-methylphenyl)methanone (PubChem CID 114028204) has the molecular formula C15H19BrClNO and a molecular weight of 344.68 g/mol. Its IUPAC name is [4-(1-bromoethyl)piperidin-1-yl]-(4-chloro-2-methylphenyl)methanone.
| Compound Name | [4-(1-bromoethyl)piperidin-1-yl]-(4-chloro-2-methylphenyl)methanone |
|---|---|
| PubChem CID | 114028204 |
| Molecular Formula | C15H19BrClNO |
| Molecular Weight | 344.68 g/mol |
| Exact Mass | 343.03 |
| IUPAC Name | [4-(1-bromoethyl)piperidin-1-yl]-(4-chloro-2-methylphenyl)methanone |
| SMILES | Cc1cc(Cl)ccc1C(=O)N1CCC(C(C)Br)CC1 |
| InChI | InChI=1S/C15H19BrClNO/c1-10-9-13(17)3-4-14(10)15(19)18-7-5-12(6-8-18)11(2)16/h3-4,9,11-12H,5-8H2,1-2H3 |
| InChIKey | ADKOMZSGUQCZRI-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.68 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|