C12H11N3OS — CID 114028602
N-(3-cyano-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl)but-3-ynamide (PubChem CID 114028602) has the molecular formula C12H11N3OS and a molecular weight of 245.31 g/mol. Its IUPAC name is N-(3-cyano-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl)but-3-ynamide.
| Compound Name | N-(3-cyano-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl)but-3-ynamide |
|---|---|
| PubChem CID | 114028602 |
| Molecular Formula | C12H11N3OS |
| Molecular Weight | 245.31 g/mol |
| Exact Mass | 245.06 |
| IUPAC Name | N-(3-cyano-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl)but-3-ynamide |
| SMILES | C#CCC(=O)Nc1sc2c(c1C#N)CCNC2 |
| InChI | InChI=1S/C12H11N3OS/c1-2-3-11(16)15-12-9(6-13)8-4-5-14-7-10(8)17-12/h1,14H,3-5,7H2,(H,15,16) |
| InChIKey | SOZOJMNYGXNSHV-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.31 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|