C14H22O5 — CID 11402979
2-[(2R,4R)-2-tert-butyl-4-(3-methylbut-2-enyl)-5-oxo-1,3-dioxolan-4-yl]acetic acid (PubChem CID 11402979) has the molecular formula C14H22O5 and a molecular weight of 270.32 g/mol. Its IUPAC name is 2-[(2R,4R)-2-tert-butyl-4-(3-methylbut-2-enyl)-5-oxo-1,3-dioxolan-4-yl]acetic acid.
| Compound Name | 2-[(2R,4R)-2-tert-butyl-4-(3-methylbut-2-enyl)-5-oxo-1,3-dioxolan-4-yl]acetic acid |
|---|---|
| PubChem CID | 11402979 |
| Molecular Formula | C14H22O5 |
| Molecular Weight | 270.32 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | 2-[(2R,4R)-2-tert-butyl-4-(3-methylbut-2-enyl)-5-oxo-1,3-dioxolan-4-yl]acetic acid |
| SMILES | CC(C)=CC[C@]1(CC(=O)O)O[C@@H](C(C)(C)C)OC1=O |
| InChI | InChI=1S/C14H22O5/c1-9(2)6-7-14(8-10(15)16)11(17)18-12(19-14)13(3,4)5/h6,12H,7-8H2,1-5H3,(H,15,16)/t12-,14+/m0/s1 |
| InChIKey | STMVYDMPZCYJIY-GXTWGEPZSA-N |
| XLogP | 2.50 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.32 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|