C11H4ClF3INOS — CID 114030007
(5-chloro-2-iodophenyl)-[2-(trifluoromethyl)-1,3-thiazol-5-yl]methanone (PubChem CID 114030007) has the molecular formula C11H4ClF3INOS and a molecular weight of 417.58 g/mol. Its IUPAC name is (5-chloro-2-iodophenyl)-[2-(trifluoromethyl)-1,3-thiazol-5-yl]methanone.
| Compound Name | (5-chloro-2-iodophenyl)-[2-(trifluoromethyl)-1,3-thiazol-5-yl]methanone |
|---|---|
| PubChem CID | 114030007 |
| Molecular Formula | C11H4ClF3INOS |
| Molecular Weight | 417.58 g/mol |
| Exact Mass | 416.87 |
| IUPAC Name | (5-chloro-2-iodophenyl)-[2-(trifluoromethyl)-1,3-thiazol-5-yl]methanone |
| SMILES | O=C(c1cnc(C(F)(F)F)s1)c1cc(Cl)ccc1I |
| InChI | InChI=1S/C11H4ClF3INOS/c12-5-1-2-7(16)6(3-5)9(18)8-4-17-10(19-8)11(13,14)15/h1-4H |
| InChIKey | JSVZBUUMNORBHE-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.58 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|