About 5-heptyl-5-phenyl-1,3-oxazolidine-2,4-dione
5-heptyl-5-phenyl-1,3-oxazolidine-2,4-dione (PubChem CID 11403113) has the molecular formula C16H21NO3
and a molecular weight of 275.35 g/mol. Its IUPAC name is 5-heptyl-5-phenyl-1,3-oxazolidine-2,4-dione.
Molecular Properties
| Compound Name | 5-heptyl-5-phenyl-1,3-oxazolidine-2,4-dione |
| PubChem CID | 11403113 |
| Molecular Formula | C16H21NO3 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | 5-heptyl-5-phenyl-1,3-oxazolidine-2,4-dione |
| SMILES | CCCCCCCC1(c2ccccc2)OC(=O)NC1=O |
| InChI | InChI=1S/C16H21NO3/c1-2-3-4-5-9-12-16(13-10-7-6-8-11-13)14(18)17-15(19)20-16/h6-8,10-11H,2-5,9,12H2,1H3,(H,17,18,19) |
| InChIKey | DNWLQPSILYIWAI-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-heptyl-5-phenyl-1,3-oxazolidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-heptyl-5-phenyl-1,3-oxazolidine-2,4-dione?
The IUPAC name of 5-heptyl-5-phenyl-1,3-oxazolidine-2,4-dione (CID 11403113) is 5-heptyl-5-phenyl-1,3-oxazolidine-2,4-dione.
What is the SMILES notation for 5-heptyl-5-phenyl-1,3-oxazolidine-2,4-dione?
The canonical SMILES for 5-heptyl-5-phenyl-1,3-oxazolidine-2,4-dione is CCCCCCCC1(c2ccccc2)OC(=O)NC1=O.
What is the InChIKey of 5-heptyl-5-phenyl-1,3-oxazolidine-2,4-dione?
The InChIKey is DNWLQPSILYIWAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21NO3/c1-2-3-4-5-9-12-16(13-10-7-6-8-11-13)14(18)17-15(19)20-16/h6-8,10-11H,2-5,9,12H2,1H3,(H,17,18,19).
What are the key properties of 5-heptyl-5-phenyl-1,3-oxazolidine-2,4-dione?
5-heptyl-5-phenyl-1,3-oxazolidine-2,4-dione has a molecular weight of 275.35 g/mol, XLogP of 3.51, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-heptyl-5-phenyl-1,3-oxazolidine-2,4-dione is sourced from PubChem (CID 11403113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).