C13H14F4O — CID 114032586
2,2,3,3-tetrafluoro-1-[3-(2-methylpropyl)phenyl]propan-1-one (PubChem CID 114032586) has the molecular formula C13H14F4O and a molecular weight of 262.25 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoro-1-[3-(2-methylpropyl)phenyl]propan-1-one.
| Compound Name | 2,2,3,3-tetrafluoro-1-[3-(2-methylpropyl)phenyl]propan-1-one |
|---|---|
| PubChem CID | 114032586 |
| Molecular Formula | C13H14F4O |
| Molecular Weight | 262.25 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | 2,2,3,3-tetrafluoro-1-[3-(2-methylpropyl)phenyl]propan-1-one |
| SMILES | CC(C)Cc1cccc(C(=O)C(F)(F)C(F)F)c1 |
| InChI | InChI=1S/C13H14F4O/c1-8(2)6-9-4-3-5-10(7-9)11(18)13(16,17)12(14)15/h3-5,7-8,12H,6H2,1-2H3 |
| InChIKey | GVUWQBKOVKVTQU-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.25 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|