C12H12BrIN2O — CID 114032600
N-(3-azabicyclo[3.1.0]hexan-6-yl)-5-bromo-2-iodobenzamide (PubChem CID 114032600) has the molecular formula C12H12BrIN2O and a molecular weight of 407.05 g/mol. Its IUPAC name is N-(3-azabicyclo[3.1.0]hexan-6-yl)-5-bromo-2-iodobenzamide.
| Compound Name | N-(3-azabicyclo[3.1.0]hexan-6-yl)-5-bromo-2-iodobenzamide |
|---|---|
| PubChem CID | 114032600 |
| Molecular Formula | C12H12BrIN2O |
| Molecular Weight | 407.05 g/mol |
| Exact Mass | 405.92 |
| IUPAC Name | N-(3-azabicyclo[3.1.0]hexan-6-yl)-5-bromo-2-iodobenzamide |
| SMILES | O=C(NC1C2CNCC21)c1cc(Br)ccc1I |
| InChI | InChI=1S/C12H12BrIN2O/c13-6-1-2-10(14)7(3-6)12(17)16-11-8-4-15-5-9(8)11/h1-3,8-9,11,15H,4-5H2,(H,16,17) |
| InChIKey | LXYPUDXDJGARNF-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.05 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|