C8H7BrF7NO2 — CID 114033006
N-(3-bromo-2-oxopropyl)-2,2,3,3-tetrafluoro-N-(2,2,2-trifluoroethyl)propanamide (PubChem CID 114033006) has the molecular formula C8H7BrF7NO2 and a molecular weight of 362.04 g/mol. Its IUPAC name is N-(3-bromo-2-oxopropyl)-2,2,3,3-tetrafluoro-N-(2,2,2-trifluoroethyl)propanamide.
| Compound Name | N-(3-bromo-2-oxopropyl)-2,2,3,3-tetrafluoro-N-(2,2,2-trifluoroethyl)propanamide |
|---|---|
| PubChem CID | 114033006 |
| Molecular Formula | C8H7BrF7NO2 |
| Molecular Weight | 362.04 g/mol |
| Exact Mass | 360.95 |
| IUPAC Name | N-(3-bromo-2-oxopropyl)-2,2,3,3-tetrafluoro-N-(2,2,2-trifluoroethyl)propanamide |
| SMILES | O=C(CBr)CN(CC(F)(F)F)C(=O)C(F)(F)C(F)F |
| InChI | InChI=1S/C8H7BrF7NO2/c9-1-4(18)2-17(3-7(12,13)14)6(19)8(15,16)5(10)11/h5H,1-3H2 |
| InChIKey | UPMPAMBGNZBZAC-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.04 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|