C16H28O4 — CID 11403378
4-(2-hydroxyethoxy)-4-methoxy-3-octylcyclopent-2-en-1-one (PubChem CID 11403378) has the molecular formula C16H28O4 and a molecular weight of 284.40 g/mol. Its IUPAC name is 4-(2-hydroxyethoxy)-4-methoxy-3-octylcyclopent-2-en-1-one.
| Compound Name | 4-(2-hydroxyethoxy)-4-methoxy-3-octylcyclopent-2-en-1-one |
|---|---|
| PubChem CID | 11403378 |
| Molecular Formula | C16H28O4 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | 4-(2-hydroxyethoxy)-4-methoxy-3-octylcyclopent-2-en-1-one |
| SMILES | CCCCCCCCC1=CC(=O)CC1(OC)OCCO |
| InChI | InChI=1S/C16H28O4/c1-3-4-5-6-7-8-9-14-12-15(18)13-16(14,19-2)20-11-10-17/h12,17H,3-11,13H2,1-2H3 |
| InChIKey | GNUOVZOLLXEKJZ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|