C19H24O2 — CID 11403381
(3aS,9bR)-6-methoxy-3a,8-dimethyl-1-propan-2-yl-4,9b-dihydro-3H-cyclopenta[a]naphthalen-5-one (PubChem CID 11403381) has the molecular formula C19H24O2 and a molecular weight of 284.40 g/mol. Its IUPAC name is (3aS,9bR)-6-methoxy-3a,8-dimethyl-1-propan-2-yl-4,9b-dihydro-3H-cyclopenta[a]naphthalen-5-one.
| Compound Name | (3aS,9bR)-6-methoxy-3a,8-dimethyl-1-propan-2-yl-4,9b-dihydro-3H-cyclopenta[a]naphthalen-5-one |
|---|---|
| PubChem CID | 11403381 |
| Molecular Formula | C19H24O2 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.18 |
| IUPAC Name | (3aS,9bR)-6-methoxy-3a,8-dimethyl-1-propan-2-yl-4,9b-dihydro-3H-cyclopenta[a]naphthalen-5-one |
| SMILES | COc1cc(C)cc2c1C(=O)C[C@]1(C)CC=C(C(C)C)[C@H]21 |
| InChI | InChI=1S/C19H24O2/c1-11(2)13-6-7-19(4)10-15(20)17-14(18(13)19)8-12(3)9-16(17)21-5/h6,8-9,11,18H,7,10H2,1-5H3/t18-,19+/m1/s1 |
| InChIKey | OLCLEVYTAZSXCU-MOPGFXCFSA-N |
| XLogP | 4.67 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|