C10H16N4O2S — CID 114034085
N-(4-amino-4-hydroxyiminobutyl)-2,4-dimethyl-1,3-thiazole-5-carboxamide (PubChem CID 114034085) has the molecular formula C10H16N4O2S and a molecular weight of 256.33 g/mol. Its IUPAC name is N-(4-amino-4-hydroxyiminobutyl)-2,4-dimethyl-1,3-thiazole-5-carboxamide.
| Compound Name | N-(4-amino-4-hydroxyiminobutyl)-2,4-dimethyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 114034085 |
| Molecular Formula | C10H16N4O2S |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | N-(4-amino-4-hydroxyiminobutyl)-2,4-dimethyl-1,3-thiazole-5-carboxamide |
| SMILES | Cc1nc(C)c(C(=O)NCCCC(N)=NO)s1 |
| InChI | InChI=1S/C10H16N4O2S/c1-6-9(17-7(2)13-6)10(15)12-5-3-4-8(11)14-16/h16H,3-5H2,1-2H3,(H2,11,14)(H,12,15) |
| InChIKey | HPEQWQAQODBXBV-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 100.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|