C18H22OS — CID 11403450
1,3,5-trimethyl-2-(2,4,6-trimethylphenyl)sulfinylbenzene (PubChem CID 11403450) has the molecular formula C18H22OS and a molecular weight of 286.44 g/mol. Its IUPAC name is 1,3,5-trimethyl-2-(2,4,6-trimethylphenyl)sulfinylbenzene.
| Compound Name | 1,3,5-trimethyl-2-(2,4,6-trimethylphenyl)sulfinylbenzene |
|---|---|
| PubChem CID | 11403450 |
| Molecular Formula | C18H22OS |
| Molecular Weight | 286.44 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | 1,3,5-trimethyl-2-(2,4,6-trimethylphenyl)sulfinylbenzene |
| SMILES | Cc1cc(C)c(S(=O)c2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C18H22OS/c1-11-7-13(3)17(14(4)8-11)20(19)18-15(5)9-12(2)10-16(18)6/h7-10H,1-6H3 |
| InChIKey | VIDWNQCJTYKBSF-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.44 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |