C12H13ClFN3S — CID 114034777
3-(chloromethyl)-5-fluoro-N-methyl-N-[(4-methyl-1,3-thiazol-5-yl)methyl]pyridin-2-amine (PubChem CID 114034777) has the molecular formula C12H13ClFN3S and a molecular weight of 285.77 g/mol. Its IUPAC name is 3-(chloromethyl)-5-fluoro-N-methyl-N-[(4-methyl-1,3-thiazol-5-yl)methyl]pyridin-2-amine.
| Compound Name | 3-(chloromethyl)-5-fluoro-N-methyl-N-[(4-methyl-1,3-thiazol-5-yl)methyl]pyridin-2-amine |
|---|---|
| PubChem CID | 114034777 |
| Molecular Formula | C12H13ClFN3S |
| Molecular Weight | 285.77 g/mol |
| Exact Mass | 285.05 |
| IUPAC Name | 3-(chloromethyl)-5-fluoro-N-methyl-N-[(4-methyl-1,3-thiazol-5-yl)methyl]pyridin-2-amine |
| SMILES | Cc1ncsc1CN(C)c1ncc(F)cc1CCl |
| InChI | InChI=1S/C12H13ClFN3S/c1-8-11(18-7-16-8)6-17(2)12-9(4-13)3-10(14)5-15-12/h3,5,7H,4,6H2,1-2H3 |
| InChIKey | MTGVMNKKHXYTOV-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.77 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|