C18H20N4 — CID 11403596
1-N,1-N,4-N-trimethyl-4-N-(2-methylquinazolin-4-yl)benzene-1,4-diamine (PubChem CID 11403596) has the molecular formula C18H20N4 and a molecular weight of 292.39 g/mol. Its IUPAC name is 1-N,1-N,4-N-trimethyl-4-N-(2-methylquinazolin-4-yl)benzene-1,4-diamine.
| Compound Name | 1-N,1-N,4-N-trimethyl-4-N-(2-methylquinazolin-4-yl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 11403596 |
| Molecular Formula | C18H20N4 |
| Molecular Weight | 292.39 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | 1-N,1-N,4-N-trimethyl-4-N-(2-methylquinazolin-4-yl)benzene-1,4-diamine |
| SMILES | Cc1nc(N(C)c2ccc(N(C)C)cc2)c2ccccc2n1 |
| InChI | InChI=1S/C18H20N4/c1-13-19-17-8-6-5-7-16(17)18(20-13)22(4)15-11-9-14(10-12-15)21(2)3/h5-12H,1-4H3 |
| InChIKey | PSBCEFQRMKLLLK-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.39 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|