C14H15NO4S — CID 11403618
methyl (1R,5R,7R)-3-benzyl-2-sulfanylidene-6,8-dioxa-3-azabicyclo[3.2.1]octane-7-carboxylate (PubChem CID 11403618) has the molecular formula C14H15NO4S and a molecular weight of 293.34 g/mol. Its IUPAC name is methyl (1R,5R,7R)-3-benzyl-2-sulfanylidene-6,8-dioxa-3-azabicyclo[3.2.1]octane-7-carboxylate.
| Compound Name | methyl (1R,5R,7R)-3-benzyl-2-sulfanylidene-6,8-dioxa-3-azabicyclo[3.2.1]octane-7-carboxylate |
|---|---|
| PubChem CID | 11403618 |
| Molecular Formula | C14H15NO4S |
| Molecular Weight | 293.34 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | methyl (1R,5R,7R)-3-benzyl-2-sulfanylidene-6,8-dioxa-3-azabicyclo[3.2.1]octane-7-carboxylate |
| SMILES | COC(=O)[C@@H]1O[C@H]2CN(Cc3ccccc3)C(=S)[C@@H]1O2 |
| InChI | InChI=1S/C14H15NO4S/c1-17-14(16)12-11-13(20)15(8-10(18-11)19-12)7-9-5-3-2-4-6-9/h2-6,10-12H,7-8H2,1H3/t10-,11+,12+/m0/s1 |
| InChIKey | LEJHSTILMWKNGC-QJPTWQEYSA-N |
| XLogP | 1.11 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.34 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|