C12H15FN2O3 — CID 114037496
4-[(2-fluoropyridine-3-carbonyl)amino]-4-methylpentanoic acid (PubChem CID 114037496) has the molecular formula C12H15FN2O3 and a molecular weight of 254.26 g/mol. Its IUPAC name is 4-[(2-fluoropyridine-3-carbonyl)amino]-4-methylpentanoic acid.
| Compound Name | 4-[(2-fluoropyridine-3-carbonyl)amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 114037496 |
| Molecular Formula | C12H15FN2O3 |
| Molecular Weight | 254.26 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | 4-[(2-fluoropyridine-3-carbonyl)amino]-4-methylpentanoic acid |
| SMILES | CC(C)(CCC(=O)O)NC(=O)c1cccnc1F |
| InChI | InChI=1S/C12H15FN2O3/c1-12(2,6-5-9(16)17)15-11(18)8-4-3-7-14-10(8)13/h3-4,7H,5-6H2,1-2H3,(H,15,18)(H,16,17) |
| InChIKey | YQTFERNNJUABLP-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.26 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|