C10H15F5N2O — CID 114038039
1-[2-(aminomethyl)-3-methylpiperidin-1-yl]-2,2,3,3,3-pentafluoropropan-1-one (PubChem CID 114038039) has the molecular formula C10H15F5N2O and a molecular weight of 274.23 g/mol. Its IUPAC name is 1-[2-(aminomethyl)-3-methylpiperidin-1-yl]-2,2,3,3,3-pentafluoropropan-1-one.
| Compound Name | 1-[2-(aminomethyl)-3-methylpiperidin-1-yl]-2,2,3,3,3-pentafluoropropan-1-one |
|---|---|
| PubChem CID | 114038039 |
| Molecular Formula | C10H15F5N2O |
| Molecular Weight | 274.23 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | 1-[2-(aminomethyl)-3-methylpiperidin-1-yl]-2,2,3,3,3-pentafluoropropan-1-one |
| SMILES | CC1CCCN(C(=O)C(F)(F)C(F)(F)F)C1CN |
| InChI | InChI=1S/C10H15F5N2O/c1-6-3-2-4-17(7(6)5-16)8(18)9(11,12)10(13,14)15/h6-7H,2-5,16H2,1H3 |
| InChIKey | NKPDGMGTIWUQCM-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.23 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|