C8H9F5N4O — CID 114038228
2,2,3,3,3-pentafluoro-N-[2-(1-methyl-1,2,4-triazol-3-yl)ethyl]propanamide (PubChem CID 114038228) has the molecular formula C8H9F5N4O and a molecular weight of 272.18 g/mol. Its IUPAC name is 2,2,3,3,3-pentafluoro-N-[2-(1-methyl-1,2,4-triazol-3-yl)ethyl]propanamide.
| Compound Name | 2,2,3,3,3-pentafluoro-N-[2-(1-methyl-1,2,4-triazol-3-yl)ethyl]propanamide |
|---|---|
| PubChem CID | 114038228 |
| Molecular Formula | C8H9F5N4O |
| Molecular Weight | 272.18 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | 2,2,3,3,3-pentafluoro-N-[2-(1-methyl-1,2,4-triazol-3-yl)ethyl]propanamide |
| SMILES | Cn1cnc(CCNC(=O)C(F)(F)C(F)(F)F)n1 |
| InChI | InChI=1S/C8H9F5N4O/c1-17-4-15-5(16-17)2-3-14-6(18)7(9,10)8(11,12)13/h4H,2-3H2,1H3,(H,14,18) |
| InChIKey | NPIFSTNABVEOAE-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.18 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|