C9H10F5NO2 — CID 114038229
2,2,3,3,3-pentafluoro-N-(7-oxabicyclo[2.2.1]heptan-2-yl)propanamide (PubChem CID 114038229) has the molecular formula C9H10F5NO2 and a molecular weight of 259.17 g/mol. Its IUPAC name is 2,2,3,3,3-pentafluoro-N-(7-oxabicyclo[2.2.1]heptan-2-yl)propanamide.
| Compound Name | 2,2,3,3,3-pentafluoro-N-(7-oxabicyclo[2.2.1]heptan-2-yl)propanamide |
|---|---|
| PubChem CID | 114038229 |
| Molecular Formula | C9H10F5NO2 |
| Molecular Weight | 259.17 g/mol |
| Exact Mass | 259.06 |
| IUPAC Name | 2,2,3,3,3-pentafluoro-N-(7-oxabicyclo[2.2.1]heptan-2-yl)propanamide |
| SMILES | O=C(NC1CC2CCC1O2)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H10F5NO2/c10-8(11,9(12,13)14)7(16)15-5-3-4-1-2-6(5)17-4/h4-6H,1-3H2,(H,15,16) |
| InChIKey | ALHRXPCMXOALKF-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.17 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|