C8H12F5NO2S — CID 114038253
2,2,3,3,3-pentafluoro-N-(4-methylsulfinylbutan-2-yl)propanamide (PubChem CID 114038253) has the molecular formula C8H12F5NO2S and a molecular weight of 281.25 g/mol. Its IUPAC name is 2,2,3,3,3-pentafluoro-N-(4-methylsulfinylbutan-2-yl)propanamide.
| Compound Name | 2,2,3,3,3-pentafluoro-N-(4-methylsulfinylbutan-2-yl)propanamide |
|---|---|
| PubChem CID | 114038253 |
| Molecular Formula | C8H12F5NO2S |
| Molecular Weight | 281.25 g/mol |
| Exact Mass | 281.05 |
| IUPAC Name | 2,2,3,3,3-pentafluoro-N-(4-methylsulfinylbutan-2-yl)propanamide |
| SMILES | CC(CCS(C)=O)NC(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H12F5NO2S/c1-5(3-4-17(2)16)14-6(15)7(9,10)8(11,12)13/h5H,3-4H2,1-2H3,(H,14,15) |
| InChIKey | VGHSUCAJRRWZIW-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.25 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|