C10H14F5NOS — CID 114038275
1-(7,7-dimethyl-1,4-thiazepan-4-yl)-2,2,3,3,3-pentafluoropropan-1-one (PubChem CID 114038275) has the molecular formula C10H14F5NOS and a molecular weight of 291.29 g/mol. Its IUPAC name is 1-(7,7-dimethyl-1,4-thiazepan-4-yl)-2,2,3,3,3-pentafluoropropan-1-one.
| Compound Name | 1-(7,7-dimethyl-1,4-thiazepan-4-yl)-2,2,3,3,3-pentafluoropropan-1-one |
|---|---|
| PubChem CID | 114038275 |
| Molecular Formula | C10H14F5NOS |
| Molecular Weight | 291.29 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | 1-(7,7-dimethyl-1,4-thiazepan-4-yl)-2,2,3,3,3-pentafluoropropan-1-one |
| SMILES | CC1(C)CCN(C(=O)C(F)(F)C(F)(F)F)CCS1 |
| InChI | InChI=1S/C10H14F5NOS/c1-8(2)3-4-16(5-6-18-8)7(17)9(11,12)10(13,14)15/h3-6H2,1-2H3 |
| InChIKey | WTGYYROHWJEAAR-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.29 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|