About 5-[5-(5-hydroxy-4,4-dimethylpentyl)oxolan-2-yl]-2,2-dimethylpentan-1-ol
5-[5-(5-hydroxy-4,4-dimethylpentyl)oxolan-2-yl]-2,2-dimethylpentan-1-ol (PubChem CID 11403838) has the molecular formula C18H36O3
and a molecular weight of 300.48 g/mol. Its IUPAC name is 5-[5-(5-hydroxy-4,4-dimethylpentyl)oxolan-2-yl]-2,2-dimethylpentan-1-ol.
Molecular Properties
| Compound Name | 5-[5-(5-hydroxy-4,4-dimethylpentyl)oxolan-2-yl]-2,2-dimethylpentan-1-ol |
| PubChem CID | 11403838 |
| Molecular Formula | C18H36O3 |
| Molecular Weight | 300.48 g/mol |
| Exact Mass | 300.27 |
| IUPAC Name | 5-[5-(5-hydroxy-4,4-dimethylpentyl)oxolan-2-yl]-2,2-dimethylpentan-1-ol |
| SMILES | CC(C)(CO)CCCC1CCC(CCCC(C)(C)CO)O1 |
| InChI | InChI=1S/C18H36O3/c1-17(2,13-19)11-5-7-15-9-10-16(21-15)8-6-12-18(3,4)14-20/h15-16,19-20H,5-14H2,1-4H3 |
| InChIKey | LIWSZZLAAZSPSM-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.48 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-[5-(5-hydroxy-4,4-dimethylpentyl)oxolan-2-yl]-2,2-dimethylpentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[5-(5-hydroxy-4,4-dimethylpentyl)oxolan-2-yl]-2,2-dimethylpentan-1-ol?
The IUPAC name of 5-[5-(5-hydroxy-4,4-dimethylpentyl)oxolan-2-yl]-2,2-dimethylpentan-1-ol (CID 11403838) is 5-[5-(5-hydroxy-4,4-dimethylpentyl)oxolan-2-yl]-2,2-dimethylpentan-1-ol.
What is the SMILES notation for 5-[5-(5-hydroxy-4,4-dimethylpentyl)oxolan-2-yl]-2,2-dimethylpentan-1-ol?
The canonical SMILES for 5-[5-(5-hydroxy-4,4-dimethylpentyl)oxolan-2-yl]-2,2-dimethylpentan-1-ol is CC(C)(CO)CCCC1CCC(CCCC(C)(C)CO)O1.
What is the InChIKey of 5-[5-(5-hydroxy-4,4-dimethylpentyl)oxolan-2-yl]-2,2-dimethylpentan-1-ol?
The InChIKey is LIWSZZLAAZSPSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H36O3/c1-17(2,13-19)11-5-7-15-9-10-16(21-15)8-6-12-18(3,4)14-20/h15-16,19-20H,5-14H2,1-4H3.
What are the key properties of 5-[5-(5-hydroxy-4,4-dimethylpentyl)oxolan-2-yl]-2,2-dimethylpentan-1-ol?
5-[5-(5-hydroxy-4,4-dimethylpentyl)oxolan-2-yl]-2,2-dimethylpentan-1-ol has a molecular weight of 300.48 g/mol, XLogP of 3.91, 10 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[5-(5-hydroxy-4,4-dimethylpentyl)oxolan-2-yl]-2,2-dimethylpentan-1-ol is sourced from PubChem (CID 11403838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).