C12H16Cl2N4O — CID 114038451
3,6-dichloro-N-(1-ethylpiperidin-4-yl)pyridazine-4-carboxamide (PubChem CID 114038451) has the molecular formula C12H16Cl2N4O and a molecular weight of 303.19 g/mol. Its IUPAC name is 3,6-dichloro-N-(1-ethylpiperidin-4-yl)pyridazine-4-carboxamide.
| Compound Name | 3,6-dichloro-N-(1-ethylpiperidin-4-yl)pyridazine-4-carboxamide |
|---|---|
| PubChem CID | 114038451 |
| Molecular Formula | C12H16Cl2N4O |
| Molecular Weight | 303.19 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | 3,6-dichloro-N-(1-ethylpiperidin-4-yl)pyridazine-4-carboxamide |
| SMILES | CCN1CCC(NC(=O)c2cc(Cl)nnc2Cl)CC1 |
| InChI | InChI=1S/C12H16Cl2N4O/c1-2-18-5-3-8(4-6-18)15-12(19)9-7-10(13)16-17-11(9)14/h7-8H,2-6H2,1H3,(H,15,19) |
| InChIKey | WPQOMPGNEIYPCR-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.19 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |