C17H25NO4 — CID 11404035
(3aR,4S,5S,6S,6aS)-5-(benzylamino)-6-(2-hydroxyethyl)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-ol (PubChem CID 11404035) has the molecular formula C17H25NO4 and a molecular weight of 307.39 g/mol. Its IUPAC name is (3aR,4S,5S,6S,6aS)-5-(benzylamino)-6-(2-hydroxyethyl)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-ol.
| Compound Name | (3aR,4S,5S,6S,6aS)-5-(benzylamino)-6-(2-hydroxyethyl)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-ol |
|---|---|
| PubChem CID | 11404035 |
| Molecular Formula | C17H25NO4 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.18 |
| IUPAC Name | (3aR,4S,5S,6S,6aS)-5-(benzylamino)-6-(2-hydroxyethyl)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-ol |
| SMILES | CC1(C)O[C@@H]2[C@@H](O)[C@@H](NCc3ccccc3)[C@H](CCO)[C@@H]2O1 |
| InChI | InChI=1S/C17H25NO4/c1-17(2)21-15-12(8-9-19)13(14(20)16(15)22-17)18-10-11-6-4-3-5-7-11/h3-7,12-16,18-20H,8-10H2,1-2H3/t12-,13-,14-,15-,16+/m0/s1 |
| InChIKey | GHBNXFCFZCITMU-UVPYHEFZSA-N |
| XLogP | 1.04 |
| TPSA | 70.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |