C10H13N5O2 — CID 114040934
3-[3-(1-aminobutyl)-1,2,4-oxadiazol-5-yl]-1H-pyridazin-6-one (PubChem CID 114040934) has the molecular formula C10H13N5O2 and a molecular weight of 235.25 g/mol. Its IUPAC name is 3-[3-(1-aminobutyl)-1,2,4-oxadiazol-5-yl]-1H-pyridazin-6-one.
| Compound Name | 3-[3-(1-aminobutyl)-1,2,4-oxadiazol-5-yl]-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 114040934 |
| Molecular Formula | C10H13N5O2 |
| Molecular Weight | 235.25 g/mol |
| Exact Mass | 235.11 |
| IUPAC Name | 3-[3-(1-aminobutyl)-1,2,4-oxadiazol-5-yl]-1H-pyridazin-6-one |
| SMILES | CCCC(N)c1noc(-c2ccc(=O)[nH]n2)n1 |
| InChI | InChI=1S/C10H13N5O2/c1-2-3-6(11)9-12-10(17-15-9)7-4-5-8(16)14-13-7/h4-6H,2-3,11H2,1H3,(H,14,16) |
| InChIKey | IPAACCKJCXYBJE-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 110.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.25 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |