About (4E,6E)-7-ethoxy-5-methylsulfanyl-4-phenylsulfanylhepta-4,6-dien-3-ol
(4E,6E)-7-ethoxy-5-methylsulfanyl-4-phenylsulfanylhepta-4,6-dien-3-ol (PubChem CID 11404129) has the molecular formula C16H22O2S2
and a molecular weight of 310.48 g/mol. Its IUPAC name is (4E,6E)-7-ethoxy-5-methylsulfanyl-4-phenylsulfanylhepta-4,6-dien-3-ol.
Molecular Properties
| Compound Name | (4E,6E)-7-ethoxy-5-methylsulfanyl-4-phenylsulfanylhepta-4,6-dien-3-ol |
| PubChem CID | 11404129 |
| Molecular Formula | C16H22O2S2 |
| Molecular Weight | 310.48 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | (4E,6E)-7-ethoxy-5-methylsulfanyl-4-phenylsulfanylhepta-4,6-dien-3-ol |
| SMILES | CCO/C=C/C(SC)=C(\Sc1ccccc1)C(O)CC |
| InChI | InChI=1S/C16H22O2S2/c1-4-14(17)16(15(19-3)11-12-18-5-2)20-13-9-7-6-8-10-13/h6-12,14,17H,4-5H2,1-3H3/b12-11+,16-15+ |
| InChIKey | WCKKPZCMXLSJRI-YBAIQQBHSA-N |
| XLogP | 4.67 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.48 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (4E,6E)-7-ethoxy-5-methylsulfanyl-4-phenylsulfanylhepta-4,6-dien-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4E,6E)-7-ethoxy-5-methylsulfanyl-4-phenylsulfanylhepta-4,6-dien-3-ol?
The IUPAC name of (4E,6E)-7-ethoxy-5-methylsulfanyl-4-phenylsulfanylhepta-4,6-dien-3-ol (CID 11404129) is (4E,6E)-7-ethoxy-5-methylsulfanyl-4-phenylsulfanylhepta-4,6-dien-3-ol.
What is the SMILES notation for (4E,6E)-7-ethoxy-5-methylsulfanyl-4-phenylsulfanylhepta-4,6-dien-3-ol?
The canonical SMILES for (4E,6E)-7-ethoxy-5-methylsulfanyl-4-phenylsulfanylhepta-4,6-dien-3-ol is CCO/C=C/C(SC)=C(\Sc1ccccc1)C(O)CC.
What is the InChIKey of (4E,6E)-7-ethoxy-5-methylsulfanyl-4-phenylsulfanylhepta-4,6-dien-3-ol?
The InChIKey is WCKKPZCMXLSJRI-YBAIQQBHSA-N. The full InChI is InChI=1S/C16H22O2S2/c1-4-14(17)16(15(19-3)11-12-18-5-2)20-13-9-7-6-8-10-13/h6-12,14,17H,4-5H2,1-3H3/b12-11+,16-15+.
What are the key properties of (4E,6E)-7-ethoxy-5-methylsulfanyl-4-phenylsulfanylhepta-4,6-dien-3-ol?
(4E,6E)-7-ethoxy-5-methylsulfanyl-4-phenylsulfanylhepta-4,6-dien-3-ol has a molecular weight of 310.48 g/mol, XLogP of 4.67, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4E,6E)-7-ethoxy-5-methylsulfanyl-4-phenylsulfanylhepta-4,6-dien-3-ol is sourced from PubChem (CID 11404129), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).