C15H20N2S — CID 114041587
3-(1-cyclopentylethyl)-7-methyl-1H-benzimidazole-2-thione (PubChem CID 114041587) has the molecular formula C15H20N2S and a molecular weight of 260.41 g/mol. Its IUPAC name is 3-(1-cyclopentylethyl)-7-methyl-1H-benzimidazole-2-thione.
| Compound Name | 3-(1-cyclopentylethyl)-7-methyl-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 114041587 |
| Molecular Formula | C15H20N2S |
| Molecular Weight | 260.41 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | 3-(1-cyclopentylethyl)-7-methyl-1H-benzimidazole-2-thione |
| SMILES | Cc1cccc2c1[nH]c(=S)n2C(C)C1CCCC1 |
| InChI | InChI=1S/C15H20N2S/c1-10-6-5-9-13-14(10)16-15(18)17(13)11(2)12-7-3-4-8-12/h5-6,9,11-12H,3-4,7-8H2,1-2H3,(H,16,18) |
| InChIKey | IMQKRKPHBMXTQS-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.41 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|