C10H11F3N2O4S — CID 11404166
(3R,6S,8aS)-5-oxo-6-[(2,2,2-trifluoroacetyl)amino]-2,3,6,7,8,8a-hexahydro-[1,3]thiazolo[3,2-a]pyridine-3-carboxylic acid (PubChem CID 11404166) has the molecular formula C10H11F3N2O4S and a molecular weight of 312.27 g/mol. Its IUPAC name is (3R,6S,8aS)-5-oxo-6-[(2,2,2-trifluoroacetyl)amino]-2,3,6,7,8,8a-hexahydro-[1,3]thiazolo[3,2-a]pyridine-3-carboxylic acid.
| Compound Name | (3R,6S,8aS)-5-oxo-6-[(2,2,2-trifluoroacetyl)amino]-2,3,6,7,8,8a-hexahydro-[1,3]thiazolo[3,2-a]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 11404166 |
| Molecular Formula | C10H11F3N2O4S |
| Molecular Weight | 312.27 g/mol |
| Exact Mass | 312.04 |
| IUPAC Name | (3R,6S,8aS)-5-oxo-6-[(2,2,2-trifluoroacetyl)amino]-2,3,6,7,8,8a-hexahydro-[1,3]thiazolo[3,2-a]pyridine-3-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CS[C@H]2CC[C@H](NC(=O)C(F)(F)F)C(=O)N21 |
| InChI | InChI=1S/C10H11F3N2O4S/c11-10(12,13)9(19)14-4-1-2-6-15(7(4)16)5(3-20-6)8(17)18/h4-6H,1-3H2,(H,14,19)(H,17,18)/t4-,5-,6-/m0/s1 |
| InChIKey | HSQCBIWLXOPCIV-ZLUOBGJFSA-N |
| XLogP | 0.18 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.27 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |