C13H18BrClFNO — CID 114042814
3-(2-bromo-4-chloro-5-fluorophenoxy)-N-ethyl-2,2-dimethylpropan-1-amine (PubChem CID 114042814) has the molecular formula C13H18BrClFNO and a molecular weight of 338.65 g/mol. Its IUPAC name is 3-(2-bromo-4-chloro-5-fluorophenoxy)-N-ethyl-2,2-dimethylpropan-1-amine.
| Compound Name | 3-(2-bromo-4-chloro-5-fluorophenoxy)-N-ethyl-2,2-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 114042814 |
| Molecular Formula | C13H18BrClFNO |
| Molecular Weight | 338.65 g/mol |
| Exact Mass | 337.02 |
| IUPAC Name | 3-(2-bromo-4-chloro-5-fluorophenoxy)-N-ethyl-2,2-dimethylpropan-1-amine |
| SMILES | CCNCC(C)(C)COc1cc(F)c(Cl)cc1Br |
| InChI | InChI=1S/C13H18BrClFNO/c1-4-17-7-13(2,3)8-18-12-6-11(16)10(15)5-9(12)14/h5-6,17H,4,7-8H2,1-3H3 |
| InChIKey | TZCUZIGWPKWDHJ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.65 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|