About 3-(2-bromo-4-chloro-5-fluorophenoxy)-4,4,4-trifluorobutanoic acid
3-(2-bromo-4-chloro-5-fluorophenoxy)-4,4,4-trifluorobutanoic acid (PubChem CID 114042848) has the molecular formula C10H6BrClF4O3
and a molecular weight of 365.50 g/mol. Its IUPAC name is 3-(2-bromo-4-chloro-5-fluorophenoxy)-4,4,4-trifluorobutanoic acid.
Molecular Properties
| Compound Name | 3-(2-bromo-4-chloro-5-fluorophenoxy)-4,4,4-trifluorobutanoic acid |
| PubChem CID | 114042848 |
| Molecular Formula | C10H6BrClF4O3 |
| Molecular Weight | 365.50 g/mol |
| Exact Mass | 363.91 |
| IUPAC Name | 3-(2-bromo-4-chloro-5-fluorophenoxy)-4,4,4-trifluorobutanoic acid |
| SMILES | O=C(O)CC(Oc1cc(F)c(Cl)cc1Br)C(F)(F)F |
| InChI | InChI=1S/C10H6BrClF4O3/c11-4-1-5(12)6(13)2-7(4)19-8(3-9(17)18)10(14,15)16/h1-2,8H,3H2,(H,17,18) |
| InChIKey | JIJXZWGTHSQCDM-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.50 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-bromo-4-chloro-5-fluorophenoxy)-4,4,4-trifluorobutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-bromo-4-chloro-5-fluorophenoxy)-4,4,4-trifluorobutanoic acid?
The IUPAC name of 3-(2-bromo-4-chloro-5-fluorophenoxy)-4,4,4-trifluorobutanoic acid (CID 114042848) is 3-(2-bromo-4-chloro-5-fluorophenoxy)-4,4,4-trifluorobutanoic acid.
What is the SMILES notation for 3-(2-bromo-4-chloro-5-fluorophenoxy)-4,4,4-trifluorobutanoic acid?
The canonical SMILES for 3-(2-bromo-4-chloro-5-fluorophenoxy)-4,4,4-trifluorobutanoic acid is O=C(O)CC(Oc1cc(F)c(Cl)cc1Br)C(F)(F)F.
What is the InChIKey of 3-(2-bromo-4-chloro-5-fluorophenoxy)-4,4,4-trifluorobutanoic acid?
The InChIKey is JIJXZWGTHSQCDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6BrClF4O3/c11-4-1-5(12)6(13)2-7(4)19-8(3-9(17)18)10(14,15)16/h1-2,8H,3H2,(H,17,18).
What are the key properties of 3-(2-bromo-4-chloro-5-fluorophenoxy)-4,4,4-trifluorobutanoic acid?
3-(2-bromo-4-chloro-5-fluorophenoxy)-4,4,4-trifluorobutanoic acid has a molecular weight of 365.50 g/mol, XLogP of 4.03, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-bromo-4-chloro-5-fluorophenoxy)-4,4,4-trifluorobutanoic acid is sourced from PubChem (CID 114042848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).