C15H24O7 — CID 11404292
methyl (4R,6S)-4-ethoxy-6-(1,1,2-trimethoxy-2-oxoethyl)cyclohexene-1-carboxylate (PubChem CID 11404292) has the molecular formula C15H24O7 and a molecular weight of 316.35 g/mol. Its IUPAC name is methyl (4R,6S)-4-ethoxy-6-(1,1,2-trimethoxy-2-oxoethyl)cyclohexene-1-carboxylate.
| Compound Name | methyl (4R,6S)-4-ethoxy-6-(1,1,2-trimethoxy-2-oxoethyl)cyclohexene-1-carboxylate |
|---|---|
| PubChem CID | 11404292 |
| Molecular Formula | C15H24O7 |
| Molecular Weight | 316.35 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | methyl (4R,6S)-4-ethoxy-6-(1,1,2-trimethoxy-2-oxoethyl)cyclohexene-1-carboxylate |
| SMILES | CCO[C@@H]1CC=C(C(=O)OC)[C@@H](C(OC)(OC)C(=O)OC)C1 |
| InChI | InChI=1S/C15H24O7/c1-6-22-10-7-8-11(13(16)18-2)12(9-10)15(20-4,21-5)14(17)19-3/h8,10,12H,6-7,9H2,1-5H3/t10-,12+/m1/s1 |
| InChIKey | FEKSEMDLAGWZOZ-PWSUYJOCSA-N |
| XLogP | 1.06 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.35 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|