About 2-chloro-N-(3-methyl-1,1-dioxothiolan-3-yl)-5-nitropyrimidin-4-amine
2-chloro-N-(3-methyl-1,1-dioxothiolan-3-yl)-5-nitropyrimidin-4-amine (PubChem CID 114043252) has the molecular formula C9H11ClN4O4S
and a molecular weight of 306.73 g/mol. Its IUPAC name is 2-chloro-N-(3-methyl-1,1-dioxothiolan-3-yl)-5-nitropyrimidin-4-amine.
Molecular Properties
| Compound Name | 2-chloro-N-(3-methyl-1,1-dioxothiolan-3-yl)-5-nitropyrimidin-4-amine |
| PubChem CID | 114043252 |
| Molecular Formula | C9H11ClN4O4S |
| Molecular Weight | 306.73 g/mol |
| Exact Mass | 306.02 |
| IUPAC Name | 2-chloro-N-(3-methyl-1,1-dioxothiolan-3-yl)-5-nitropyrimidin-4-amine |
| SMILES | CC1(Nc2nc(Cl)ncc2[N+](=O)[O-])CCS(=O)(=O)C1 |
| InChI | InChI=1S/C9H11ClN4O4S/c1-9(2-3-19(17,18)5-9)13-7-6(14(15)16)4-11-8(10)12-7/h4H,2-3,5H2,1H3,(H,11,12,13) |
| InChIKey | FGVDNPKVXGEMDP-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 115.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.73 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-N-(3-methyl-1,1-dioxothiolan-3-yl)-5-nitropyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N-(3-methyl-1,1-dioxothiolan-3-yl)-5-nitropyrimidin-4-amine?
The IUPAC name of 2-chloro-N-(3-methyl-1,1-dioxothiolan-3-yl)-5-nitropyrimidin-4-amine (CID 114043252) is 2-chloro-N-(3-methyl-1,1-dioxothiolan-3-yl)-5-nitropyrimidin-4-amine.
What is the SMILES notation for 2-chloro-N-(3-methyl-1,1-dioxothiolan-3-yl)-5-nitropyrimidin-4-amine?
The canonical SMILES for 2-chloro-N-(3-methyl-1,1-dioxothiolan-3-yl)-5-nitropyrimidin-4-amine is CC1(Nc2nc(Cl)ncc2[N+](=O)[O-])CCS(=O)(=O)C1.
What is the InChIKey of 2-chloro-N-(3-methyl-1,1-dioxothiolan-3-yl)-5-nitropyrimidin-4-amine?
The InChIKey is FGVDNPKVXGEMDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11ClN4O4S/c1-9(2-3-19(17,18)5-9)13-7-6(14(15)16)4-11-8(10)12-7/h4H,2-3,5H2,1H3,(H,11,12,13).
What are the key properties of 2-chloro-N-(3-methyl-1,1-dioxothiolan-3-yl)-5-nitropyrimidin-4-amine?
2-chloro-N-(3-methyl-1,1-dioxothiolan-3-yl)-5-nitropyrimidin-4-amine has a molecular weight of 306.73 g/mol, XLogP of 1.03, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N-(3-methyl-1,1-dioxothiolan-3-yl)-5-nitropyrimidin-4-amine is sourced from PubChem (CID 114043252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).