C15H26O7 — CID 11404358
(1S,2S,3S,4R,5R)-5-ethoxycarbonyl-2,4-dihydroxy-3-pentan-3-yloxycyclohexane-1-carboxylic acid (PubChem CID 11404358) has the molecular formula C15H26O7 and a molecular weight of 318.37 g/mol. Its IUPAC name is (1S,2S,3S,4R,5R)-5-ethoxycarbonyl-2,4-dihydroxy-3-pentan-3-yloxycyclohexane-1-carboxylic acid.
| Compound Name | (1S,2S,3S,4R,5R)-5-ethoxycarbonyl-2,4-dihydroxy-3-pentan-3-yloxycyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 11404358 |
| Molecular Formula | C15H26O7 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | (1S,2S,3S,4R,5R)-5-ethoxycarbonyl-2,4-dihydroxy-3-pentan-3-yloxycyclohexane-1-carboxylic acid |
| SMILES | CCOC(=O)[C@@H]1C[C@H](C(=O)O)[C@H](O)[C@H](OC(CC)CC)[C@@H]1O |
| InChI | InChI=1S/C15H26O7/c1-4-8(5-2)22-13-11(16)9(14(18)19)7-10(12(13)17)15(20)21-6-3/h8-13,16-17H,4-7H2,1-3H3,(H,18,19)/t9-,10+,11-,12+,13-/m0/s1 |
| InChIKey | IUPFOTGDTWSNMP-OFTGVCEQSA-N |
| XLogP | 0.57 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |