C12H19ClN4 — CID 114043901
2-chloro-4-(3,3-diethylpyrrolidin-1-yl)pyrimidin-5-amine (PubChem CID 114043901) has the molecular formula C12H19ClN4 and a molecular weight of 254.76 g/mol. Its IUPAC name is 2-chloro-4-(3,3-diethylpyrrolidin-1-yl)pyrimidin-5-amine.
| Compound Name | 2-chloro-4-(3,3-diethylpyrrolidin-1-yl)pyrimidin-5-amine |
|---|---|
| PubChem CID | 114043901 |
| Molecular Formula | C12H19ClN4 |
| Molecular Weight | 254.76 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | 2-chloro-4-(3,3-diethylpyrrolidin-1-yl)pyrimidin-5-amine |
| SMILES | CCC1(CC)CCN(c2nc(Cl)ncc2N)C1 |
| InChI | InChI=1S/C12H19ClN4/c1-3-12(4-2)5-6-17(8-12)10-9(14)7-15-11(13)16-10/h7H,3-6,8,14H2,1-2H3 |
| InChIKey | WPTUZNLAQHKQOT-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.76 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |