C11H13ClN4O — CID 114044663
2-chloro-4-methyl-5,6a,7,8,9,10-hexahydropyrido[2,1-h]pteridin-6-one (PubChem CID 114044663) has the molecular formula C11H13ClN4O and a molecular weight of 252.70 g/mol. Its IUPAC name is 2-chloro-4-methyl-5,6a,7,8,9,10-hexahydropyrido[2,1-h]pteridin-6-one.
| Compound Name | 2-chloro-4-methyl-5,6a,7,8,9,10-hexahydropyrido[2,1-h]pteridin-6-one |
|---|---|
| PubChem CID | 114044663 |
| Molecular Formula | C11H13ClN4O |
| Molecular Weight | 252.70 g/mol |
| Exact Mass | 252.08 |
| IUPAC Name | 2-chloro-4-methyl-5,6a,7,8,9,10-hexahydropyrido[2,1-h]pteridin-6-one |
| SMILES | Cc1nc(Cl)nc2c1NC(=O)C1CCCCN21 |
| InChI | InChI=1S/C11H13ClN4O/c1-6-8-9(15-11(12)13-6)16-5-3-2-4-7(16)10(17)14-8/h7H,2-5H2,1H3,(H,14,17) |
| InChIKey | JRQBHHZSFVOVRQ-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.70 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |