C12H11BrF3NO2 — CID 114044954
methyl 1-[2-bromo-5-(trifluoromethyl)phenyl]azetidine-2-carboxylate (PubChem CID 114044954) has the molecular formula C12H11BrF3NO2 and a molecular weight of 338.12 g/mol. Its IUPAC name is methyl 1-[2-bromo-5-(trifluoromethyl)phenyl]azetidine-2-carboxylate.
| Compound Name | methyl 1-[2-bromo-5-(trifluoromethyl)phenyl]azetidine-2-carboxylate |
|---|---|
| PubChem CID | 114044954 |
| Molecular Formula | C12H11BrF3NO2 |
| Molecular Weight | 338.12 g/mol |
| Exact Mass | 336.99 |
| IUPAC Name | methyl 1-[2-bromo-5-(trifluoromethyl)phenyl]azetidine-2-carboxylate |
| SMILES | COC(=O)C1CCN1c1cc(C(F)(F)F)ccc1Br |
| InChI | InChI=1S/C12H11BrF3NO2/c1-19-11(18)9-4-5-17(9)10-6-7(12(14,15)16)2-3-8(10)13/h2-3,6,9H,4-5H2,1H3 |
| InChIKey | ZOQHNNILKHMIMZ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.12 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |