C12H19BrN4 — CID 114047266
3-[(5-bromo-6-methyl-2-pyridinyl)-ethylamino]-2-methylpropanimidamide (PubChem CID 114047266) has the molecular formula C12H19BrN4 and a molecular weight of 299.22 g/mol. Its IUPAC name is 3-[(5-bromo-6-methyl-2-pyridinyl)-ethylamino]-2-methylpropanimidamide.
| Compound Name | 3-[(5-bromo-6-methyl-2-pyridinyl)-ethylamino]-2-methylpropanimidamide |
|---|---|
| PubChem CID | 114047266 |
| Molecular Formula | C12H19BrN4 |
| Molecular Weight | 299.22 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | 3-[(5-bromo-6-methyl-2-pyridinyl)-ethylamino]-2-methylpropanimidamide |
| SMILES | [H]/N=C(\N)C(C)CN(CC)c1ccc(Br)c(C)n1 |
| InChI | InChI=1S/C12H19BrN4/c1-4-17(7-8(2)12(14)15)11-6-5-10(13)9(3)16-11/h5-6,8H,4,7H2,1-3H3,(H3,14,15) |
| InChIKey | VCCPOVNDFRHQSG-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 66.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.22 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|