C11H11BrN4O2 — CID 114048079
2-bromo-N-(1H-imidazol-5-ylmethyl)-5-methyl-4-nitroaniline (PubChem CID 114048079) has the molecular formula C11H11BrN4O2 and a molecular weight of 311.14 g/mol. Its IUPAC name is 2-bromo-N-(1H-imidazol-5-ylmethyl)-5-methyl-4-nitroaniline.
| Compound Name | 2-bromo-N-(1H-imidazol-5-ylmethyl)-5-methyl-4-nitroaniline |
|---|---|
| PubChem CID | 114048079 |
| Molecular Formula | C11H11BrN4O2 |
| Molecular Weight | 311.14 g/mol |
| Exact Mass | 310.01 |
| IUPAC Name | 2-bromo-N-(1H-imidazol-5-ylmethyl)-5-methyl-4-nitroaniline |
| SMILES | Cc1cc(NCc2cnc[nH]2)c(Br)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H11BrN4O2/c1-7-2-10(9(12)3-11(7)16(17)18)14-5-8-4-13-6-15-8/h2-4,6,14H,5H2,1H3,(H,13,15) |
| InChIKey | HBEUESUKZXWGRU-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 83.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.14 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|