About 5-bromo-2-methyl-4-(3,3,4-trimethylpiperazin-1-yl)aniline
5-bromo-2-methyl-4-(3,3,4-trimethylpiperazin-1-yl)aniline (PubChem CID 114048254) has the molecular formula C14H22BrN3
and a molecular weight of 312.26 g/mol. Its IUPAC name is 5-bromo-2-methyl-4-(3,3,4-trimethylpiperazin-1-yl)aniline.
Molecular Properties
| Compound Name | 5-bromo-2-methyl-4-(3,3,4-trimethylpiperazin-1-yl)aniline |
| PubChem CID | 114048254 |
| Molecular Formula | C14H22BrN3 |
| Molecular Weight | 312.26 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | 5-bromo-2-methyl-4-(3,3,4-trimethylpiperazin-1-yl)aniline |
| SMILES | Cc1cc(N2CCN(C)C(C)(C)C2)c(Br)cc1N |
| InChI | InChI=1S/C14H22BrN3/c1-10-7-13(11(15)8-12(10)16)18-6-5-17(4)14(2,3)9-18/h7-8H,5-6,9,16H2,1-4H3 |
| InChIKey | FYFLDVXFCGKJCN-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.26 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-2-methyl-4-(3,3,4-trimethylpiperazin-1-yl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2-methyl-4-(3,3,4-trimethylpiperazin-1-yl)aniline?
The IUPAC name of 5-bromo-2-methyl-4-(3,3,4-trimethylpiperazin-1-yl)aniline (CID 114048254) is 5-bromo-2-methyl-4-(3,3,4-trimethylpiperazin-1-yl)aniline.
What is the SMILES notation for 5-bromo-2-methyl-4-(3,3,4-trimethylpiperazin-1-yl)aniline?
The canonical SMILES for 5-bromo-2-methyl-4-(3,3,4-trimethylpiperazin-1-yl)aniline is Cc1cc(N2CCN(C)C(C)(C)C2)c(Br)cc1N.
What is the InChIKey of 5-bromo-2-methyl-4-(3,3,4-trimethylpiperazin-1-yl)aniline?
The InChIKey is FYFLDVXFCGKJCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22BrN3/c1-10-7-13(11(15)8-12(10)16)18-6-5-17(4)14(2,3)9-18/h7-8H,5-6,9,16H2,1-4H3.
What are the key properties of 5-bromo-2-methyl-4-(3,3,4-trimethylpiperazin-1-yl)aniline?
5-bromo-2-methyl-4-(3,3,4-trimethylpiperazin-1-yl)aniline has a molecular weight of 312.26 g/mol, XLogP of 2.87, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2-methyl-4-(3,3,4-trimethylpiperazin-1-yl)aniline is sourced from PubChem (CID 114048254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).