C16H15N7O2 — CID 11404963
4-[6-(3-aminophenoxy)-1-ethylimidazo[4,5-c]pyridin-2-yl]-1,2,5-oxadiazol-3-amine (PubChem CID 11404963) has the molecular formula C16H15N7O2 and a molecular weight of 337.34 g/mol. Its IUPAC name is 4-[6-(3-aminophenoxy)-1-ethylimidazo[4,5-c]pyridin-2-yl]-1,2,5-oxadiazol-3-amine.
| Compound Name | 4-[6-(3-aminophenoxy)-1-ethylimidazo[4,5-c]pyridin-2-yl]-1,2,5-oxadiazol-3-amine |
|---|---|
| PubChem CID | 11404963 |
| Molecular Formula | C16H15N7O2 |
| Molecular Weight | 337.34 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | 4-[6-(3-aminophenoxy)-1-ethylimidazo[4,5-c]pyridin-2-yl]-1,2,5-oxadiazol-3-amine |
| SMILES | CCn1c(-c2nonc2N)nc2cnc(Oc3cccc(N)c3)cc21 |
| InChI | InChI=1S/C16H15N7O2/c1-2-23-12-7-13(24-10-5-3-4-9(17)6-10)19-8-11(12)20-16(23)14-15(18)22-25-21-14/h3-8H,2,17H2,1H3,(H2,18,22) |
| InChIKey | JKABLSMROTXCMJ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 130.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.34 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|