About dichloro-bis(2,4,6-trimethylphenyl)silane
dichloro-bis(2,4,6-trimethylphenyl)silane (PubChem CID 11404964) has the molecular formula C18H22Cl2Si
and a molecular weight of 337.37 g/mol. Its IUPAC name is dichloro-bis(2,4,6-trimethylphenyl)silane.
Molecular Properties
| Compound Name | dichloro-bis(2,4,6-trimethylphenyl)silane |
| PubChem CID | 11404964 |
| Molecular Formula | C18H22Cl2Si |
| Molecular Weight | 337.37 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | dichloro-bis(2,4,6-trimethylphenyl)silane |
| SMILES | Cc1cc(C)c([Si](Cl)(Cl)c2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C18H22Cl2Si/c1-11-7-13(3)17(14(4)8-11)21(19,20)18-15(5)9-12(2)10-16(18)6/h7-10H,1-6H3 |
| InChIKey | RUSBLLCPBKKDKQ-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.37 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze dichloro-bis(2,4,6-trimethylphenyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloro-bis(2,4,6-trimethylphenyl)silane?
The IUPAC name of dichloro-bis(2,4,6-trimethylphenyl)silane (CID 11404964) is dichloro-bis(2,4,6-trimethylphenyl)silane.
What is the SMILES notation for dichloro-bis(2,4,6-trimethylphenyl)silane?
The canonical SMILES for dichloro-bis(2,4,6-trimethylphenyl)silane is Cc1cc(C)c([Si](Cl)(Cl)c2c(C)cc(C)cc2C)c(C)c1.
What is the InChIKey of dichloro-bis(2,4,6-trimethylphenyl)silane?
The InChIKey is RUSBLLCPBKKDKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22Cl2Si/c1-11-7-13(3)17(14(4)8-11)21(19,20)18-15(5)9-12(2)10-16(18)6/h7-10H,1-6H3.
What are the key properties of dichloro-bis(2,4,6-trimethylphenyl)silane?
dichloro-bis(2,4,6-trimethylphenyl)silane has a molecular weight of 337.37 g/mol, XLogP of 4.57, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dichloro-bis(2,4,6-trimethylphenyl)silane is sourced from PubChem (CID 11404964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).