C10H11ClF3N3O — CID 114050956
2-amino-N-(2-chloro-5-methyl-3-pyridinyl)-3,3,3-trifluoro-2-methylpropanamide (PubChem CID 114050956) has the molecular formula C10H11ClF3N3O and a molecular weight of 281.67 g/mol. Its IUPAC name is 2-amino-N-(2-chloro-5-methyl-3-pyridinyl)-3,3,3-trifluoro-2-methylpropanamide.
| Compound Name | 2-amino-N-(2-chloro-5-methyl-3-pyridinyl)-3,3,3-trifluoro-2-methylpropanamide |
|---|---|
| PubChem CID | 114050956 |
| Molecular Formula | C10H11ClF3N3O |
| Molecular Weight | 281.67 g/mol |
| Exact Mass | 281.05 |
| IUPAC Name | 2-amino-N-(2-chloro-5-methyl-3-pyridinyl)-3,3,3-trifluoro-2-methylpropanamide |
| SMILES | Cc1cnc(Cl)c(NC(=O)C(C)(N)C(F)(F)F)c1 |
| InChI | InChI=1S/C10H11ClF3N3O/c1-5-3-6(7(11)16-4-5)17-8(18)9(2,15)10(12,13)14/h3-4H,15H2,1-2H3,(H,17,18) |
| InChIKey | YFOBLUVCQNRTLG-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.67 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|