C13H13BrN4 — CID 114051573
4-[[(2-bromo-3-pyridinyl)amino]methyl]-1,5-dimethylpyrrole-2-carbonitrile (PubChem CID 114051573) has the molecular formula C13H13BrN4 and a molecular weight of 305.18 g/mol. Its IUPAC name is 4-[[(2-bromo-3-pyridinyl)amino]methyl]-1,5-dimethylpyrrole-2-carbonitrile.
| Compound Name | 4-[[(2-bromo-3-pyridinyl)amino]methyl]-1,5-dimethylpyrrole-2-carbonitrile |
|---|---|
| PubChem CID | 114051573 |
| Molecular Formula | C13H13BrN4 |
| Molecular Weight | 305.18 g/mol |
| Exact Mass | 304.03 |
| IUPAC Name | 4-[[(2-bromo-3-pyridinyl)amino]methyl]-1,5-dimethylpyrrole-2-carbonitrile |
| SMILES | Cc1c(CNc2cccnc2Br)cc(C#N)n1C |
| InChI | InChI=1S/C13H13BrN4/c1-9-10(6-11(7-15)18(9)2)8-17-12-4-3-5-16-13(12)14/h3-6,17H,8H2,1-2H3 |
| InChIKey | BTQHABAVUBBXEJ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 53.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.18 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|