C12H9BrClN3O2 — CID 114052084
N-(5-bromo-2-chloro-3-pyridinyl)-6-methyl-4-oxo-1H-pyridine-3-carboxamide (PubChem CID 114052084) has the molecular formula C12H9BrClN3O2 and a molecular weight of 342.58 g/mol. Its IUPAC name is N-(5-bromo-2-chloro-3-pyridinyl)-6-methyl-4-oxo-1H-pyridine-3-carboxamide.
| Compound Name | N-(5-bromo-2-chloro-3-pyridinyl)-6-methyl-4-oxo-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 114052084 |
| Molecular Formula | C12H9BrClN3O2 |
| Molecular Weight | 342.58 g/mol |
| Exact Mass | 340.96 |
| IUPAC Name | N-(5-bromo-2-chloro-3-pyridinyl)-6-methyl-4-oxo-1H-pyridine-3-carboxamide |
| SMILES | Cc1cc(=O)c(C(=O)Nc2cc(Br)cnc2Cl)c[nH]1 |
| InChI | InChI=1S/C12H9BrClN3O2/c1-6-2-10(18)8(5-15-6)12(19)17-9-3-7(13)4-16-11(9)14/h2-5H,1H3,(H,15,18)(H,17,19) |
| InChIKey | PPURPUJCMWFBHX-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.58 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|