C16H28O6Si — CID 11405212
dimethyl (1S,2R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-2-hydroxycyclohex-3-ene-1,2-dicarboxylate (PubChem CID 11405212) has the molecular formula C16H28O6Si and a molecular weight of 344.48 g/mol. Its IUPAC name is dimethyl (1S,2R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-2-hydroxycyclohex-3-ene-1,2-dicarboxylate.
| Compound Name | dimethyl (1S,2R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-2-hydroxycyclohex-3-ene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 11405212 |
| Molecular Formula | C16H28O6Si |
| Molecular Weight | 344.48 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | dimethyl (1S,2R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-2-hydroxycyclohex-3-ene-1,2-dicarboxylate |
| SMILES | COC(=O)[C@H]1C[C@H](O[Si](C)(C)C(C)(C)C)C=C[C@]1(O)C(=O)OC |
| InChI | InChI=1S/C16H28O6Si/c1-15(2,3)23(6,7)22-11-8-9-16(19,14(18)21-5)12(10-11)13(17)20-4/h8-9,11-12,19H,10H2,1-7H3/t11-,12-,16-/m1/s1 |
| InChIKey | LTQCBSUGAZPYFK-XHBSWPGZSA-N |
| XLogP | 2.03 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.48 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|