C14H26O2Sn — CID 11405224
[(2S)-6,6-dimethyl-2-prop-2-enyl-4,8-dioxaspiro[2.5]octan-2-yl]-trimethylstannane (PubChem CID 11405224) has the molecular formula C14H26O2Sn and a molecular weight of 345.07 g/mol. Its IUPAC name is [(2S)-6,6-dimethyl-2-prop-2-enyl-4,8-dioxaspiro[2.5]octan-2-yl]-trimethylstannane.
| Compound Name | [(2S)-6,6-dimethyl-2-prop-2-enyl-4,8-dioxaspiro[2.5]octan-2-yl]-trimethylstannane |
|---|---|
| PubChem CID | 11405224 |
| Molecular Formula | C14H26O2Sn |
| Molecular Weight | 345.07 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | [(2S)-6,6-dimethyl-2-prop-2-enyl-4,8-dioxaspiro[2.5]octan-2-yl]-trimethylstannane |
| SMILES | C=CC[C@]1([Sn](C)(C)C)CC12OCC(C)(C)CO2 |
| InChI | InChI=1S/C11H17O2.3CH3.Sn/c1-4-5-9-6-11(9)12-7-10(2,3)8-13-11;;;;/h4H,1,5-8H2,2-3H3;3*1H3; |
| InChIKey | BXMZCVULLOATLU-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.07 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|