C10H14ClN3O3S — CID 114052256
2-amino-N-(4-chloro-2-pyridinyl)-4-methylsulfonylbutanamide (PubChem CID 114052256) has the molecular formula C10H14ClN3O3S and a molecular weight of 291.76 g/mol. Its IUPAC name is 2-amino-N-(4-chloro-2-pyridinyl)-4-methylsulfonylbutanamide.
| Compound Name | 2-amino-N-(4-chloro-2-pyridinyl)-4-methylsulfonylbutanamide |
|---|---|
| PubChem CID | 114052256 |
| Molecular Formula | C10H14ClN3O3S |
| Molecular Weight | 291.76 g/mol |
| Exact Mass | 291.04 |
| IUPAC Name | 2-amino-N-(4-chloro-2-pyridinyl)-4-methylsulfonylbutanamide |
| SMILES | CS(=O)(=O)CCC(N)C(=O)Nc1cc(Cl)ccn1 |
| InChI | InChI=1S/C10H14ClN3O3S/c1-18(16,17)5-3-8(12)10(15)14-9-6-7(11)2-4-13-9/h2,4,6,8H,3,5,12H2,1H3,(H,13,14,15) |
| InChIKey | RCVCCFPEASESON-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.76 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |