C22H34O3 — CID 11405267
[(4aS,4bR,8R,8aR,9R,10aR)-2-ethenyl-8-(hydroxymethyl)-1,4b,8-trimethyl-3,4,4a,5,6,7,8a,9,10,10a-decahydrophenanthren-9-yl] acetate (PubChem CID 11405267) has the molecular formula C22H34O3 and a molecular weight of 346.51 g/mol. Its IUPAC name is [(4aS,4bR,8R,8aR,9R,10aR)-2-ethenyl-8-(hydroxymethyl)-1,4b,8-trimethyl-3,4,4a,5,6,7,8a,9,10,10a-decahydrophenanthren-9-yl] acetate.
| Compound Name | [(4aS,4bR,8R,8aR,9R,10aR)-2-ethenyl-8-(hydroxymethyl)-1,4b,8-trimethyl-3,4,4a,5,6,7,8a,9,10,10a-decahydrophenanthren-9-yl] acetate |
|---|---|
| PubChem CID | 11405267 |
| Molecular Formula | C22H34O3 |
| Molecular Weight | 346.51 g/mol |
| Exact Mass | 346.25 |
| IUPAC Name | [(4aS,4bR,8R,8aR,9R,10aR)-2-ethenyl-8-(hydroxymethyl)-1,4b,8-trimethyl-3,4,4a,5,6,7,8a,9,10,10a-decahydrophenanthren-9-yl] acetate |
| SMILES | C=CC1=C(C)[C@@H]2C[C@@H](OC(C)=O)[C@H]3[C@](C)(CO)CCC[C@]3(C)[C@H]2CC1 |
| InChI | InChI=1S/C22H34O3/c1-6-16-8-9-18-17(14(16)2)12-19(25-15(3)24)20-21(4,13-23)10-7-11-22(18,20)5/h6,17-20,23H,1,7-13H2,2-5H3/t17-,18-,19+,20-,21-,22+/m0/s1 |
| InChIKey | XPBOSVHDPKPTRS-KINXCBNHSA-N |
| XLogP | 4.66 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.51 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |